C20H15N5O2 — CID 109087397
2-N-(4-cyanophenyl)-4-N-(pyridin-3-ylmethyl)pyridine-2,4-dicarboxamide (PubChem CID 109087397) has the molecular formula C20H15N5O2 and a molecular weight of 357.37 g/mol. Its IUPAC name is 2-N-(4-cyanophenyl)-4-N-(pyridin-3-ylmethyl)pyridine-2,4-dicarboxamide.
| Compound Name | 2-N-(4-cyanophenyl)-4-N-(pyridin-3-ylmethyl)pyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109087397 |
| Molecular Formula | C20H15N5O2 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 2-N-(4-cyanophenyl)-4-N-(pyridin-3-ylmethyl)pyridine-2,4-dicarboxamide |
| SMILES | N#Cc1ccc(NC(=O)c2cc(C(=O)NCc3cccnc3)ccn2)cc1 |
| InChI | InChI=1S/C20H15N5O2/c21-11-14-3-5-17(6-4-14)25-20(27)18-10-16(7-9-23-18)19(26)24-13-15-2-1-8-22-12-15/h1-10,12H,13H2,(H,24,26)(H,25,27) |
| InChIKey | KPISHKMBOSBURN-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |