C17H32 — CID 10908806
3,4-ditert-butyl-6,6-dimethylhepta-1,4-diene (PubChem CID 10908806) has the molecular formula C17H32 and a molecular weight of 236.44 g/mol. Its IUPAC name is 3,4-ditert-butyl-6,6-dimethylhepta-1,4-diene.
| Compound Name | 3,4-ditert-butyl-6,6-dimethylhepta-1,4-diene |
|---|---|
| PubChem CID | 10908806 |
| Molecular Formula | C17H32 |
| Molecular Weight | 236.44 g/mol |
| Exact Mass | 236.25 |
| IUPAC Name | 3,4-ditert-butyl-6,6-dimethylhepta-1,4-diene |
| SMILES | C=CC(C(=CC(C)(C)C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C17H32/c1-11-13(16(5,6)7)14(17(8,9)10)12-15(2,3)4/h11-13H,1H2,2-10H3 |
| InChIKey | HQUWAYKSEZYMIN-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.44 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|