About 3-(2-bromophenyl)sulfanyl-5-(4-chlorophenyl)-2-methyl-1,2-thiazol-2-ium
3-(2-bromophenyl)sulfanyl-5-(4-chlorophenyl)-2-methyl-1,2-thiazol-2-ium (PubChem CID 10908899) has the molecular formula C16H12BrClNS2+
and a molecular weight of 397.77 g/mol. Its IUPAC name is 3-(2-bromophenyl)sulfanyl-5-(4-chlorophenyl)-2-methyl-1,2-thiazol-2-ium.
Molecular Properties
| Compound Name | 3-(2-bromophenyl)sulfanyl-5-(4-chlorophenyl)-2-methyl-1,2-thiazol-2-ium |
| PubChem CID | 10908899 |
| Molecular Formula | C16H12BrClNS2+ |
| Molecular Weight | 397.77 g/mol |
| Exact Mass | 395.93 |
| IUPAC Name | 3-(2-bromophenyl)sulfanyl-5-(4-chlorophenyl)-2-methyl-1,2-thiazol-2-ium |
| SMILES | C[n+]1sc(-c2ccc(Cl)cc2)cc1Sc1ccccc1Br |
| InChI | InChI=1S/C16H12BrClNS2/c1-19-16(20-14-5-3-2-4-13(14)17)10-15(21-19)11-6-8-12(18)9-7-11/h2-10H,1H3/q+1 |
| InChIKey | SDXAXPVATRAKGV-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 397.77 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-bromophenyl)sulfanyl-5-(4-chlorophenyl)-2-methyl-1,2-thiazol-2-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-bromophenyl)sulfanyl-5-(4-chlorophenyl)-2-methyl-1,2-thiazol-2-ium?
The IUPAC name of 3-(2-bromophenyl)sulfanyl-5-(4-chlorophenyl)-2-methyl-1,2-thiazol-2-ium (CID 10908899) is 3-(2-bromophenyl)sulfanyl-5-(4-chlorophenyl)-2-methyl-1,2-thiazol-2-ium.
What is the SMILES notation for 3-(2-bromophenyl)sulfanyl-5-(4-chlorophenyl)-2-methyl-1,2-thiazol-2-ium?
The canonical SMILES for 3-(2-bromophenyl)sulfanyl-5-(4-chlorophenyl)-2-methyl-1,2-thiazol-2-ium is C[n+]1sc(-c2ccc(Cl)cc2)cc1Sc1ccccc1Br.
What is the InChIKey of 3-(2-bromophenyl)sulfanyl-5-(4-chlorophenyl)-2-methyl-1,2-thiazol-2-ium?
The InChIKey is SDXAXPVATRAKGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12BrClNS2/c1-19-16(20-14-5-3-2-4-13(14)17)10-15(21-19)11-6-8-12(18)9-7-11/h2-10H,1H3/q+1.
What are the key properties of 3-(2-bromophenyl)sulfanyl-5-(4-chlorophenyl)-2-methyl-1,2-thiazol-2-ium?
3-(2-bromophenyl)sulfanyl-5-(4-chlorophenyl)-2-methyl-1,2-thiazol-2-ium has a molecular weight of 397.77 g/mol, XLogP of 5.81, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-bromophenyl)sulfanyl-5-(4-chlorophenyl)-2-methyl-1,2-thiazol-2-ium is sourced from PubChem (CID 10908899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).