C56H54N4 — CID 10908911
4-[2-[1-[2-[2,2-bis[4-(dimethylamino)phenyl]ethenyl]naphthalen-1-yl]naphthalen-2-yl]-1-[4-(dimethylamino)phenyl]ethenyl]-N,N-dimethylaniline (PubChem CID 10908911) has the molecular formula C56H54N4 and a molecular weight of 783.08 g/mol. Its IUPAC name is 4-[2-[1-[2-[2,2-bis[4-(dimethylamino)phenyl]ethenyl]naphthalen-1-yl]naphthalen-2-yl]-1-[4-(dimethylamino)phenyl]ethenyl]-N,N-dimethylaniline.
| Compound Name | 4-[2-[1-[2-[2,2-bis[4-(dimethylamino)phenyl]ethenyl]naphthalen-1-yl]naphthalen-2-yl]-1-[4-(dimethylamino)phenyl]ethenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 10908911 |
| Molecular Formula | C56H54N4 |
| Molecular Weight | 783.08 g/mol |
| Exact Mass | 782.43 |
| IUPAC Name | 4-[2-[1-[2-[2,2-bis[4-(dimethylamino)phenyl]ethenyl]naphthalen-1-yl]naphthalen-2-yl]-1-[4-(dimethylamino)phenyl]ethenyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(C(=Cc2ccc3ccccc3c2-c2c(C=C(c3ccc(N(C)C)cc3)c3ccc(N(C)C)cc3)ccc3ccccc23)c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C56H54N4/c1-57(2)47-29-21-41(22-30-47)53(42-23-31-48(32-24-42)58(3)4)37-45-19-17-39-13-9-11-15-51(39)55(45)56-46(20-18-40-14-10-12-16-52(40)56)38-54(43-25-33-49(34-26-43)59(5)6)44-27-35-50(36-28-44)60(7)8/h9-38H,1-8H3 |
| InChIKey | GVTHRUJDUOSDLL-UHFFFAOYSA-N |
| XLogP | 13.10 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.08 |
| LogP ≤ 5 | 13.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|