C38H56Br2N4O4 — CID 10908937
[2,2-dimethyl-3-(5-methyl-1,3-dioxoisoindol-2-yl)propyl]-[6-[[2,2-dimethyl-3-(5-methyl-1,3-dioxoisoindol-2-yl)propyl]-dimethylazaniumyl]hexyl]-dimethylazanium dibromide (PubChem CID 10908937) has the molecular formula C38H56Br2N4O4 and a molecular weight of 792.70 g/mol. Its IUPAC name is [2,2-dimethyl-3-(5-methyl-1,3-dioxoisoindol-2-yl)propyl]-[6-[[2,2-dimethyl-3-(5-methyl-1,3-dioxoisoindol-2-yl)propyl]-dimethylazaniumyl]hexyl]-dimethylazanium dibromide.
| Compound Name | [2,2-dimethyl-3-(5-methyl-1,3-dioxoisoindol-2-yl)propyl]-[6-[[2,2-dimethyl-3-(5-methyl-1,3-dioxoisoindol-2-yl)propyl]-dimethylazaniumyl]hexyl]-dimethylazanium dibromide |
|---|---|
| PubChem CID | 10908937 |
| Molecular Formula | C38H56Br2N4O4 |
| Molecular Weight | 792.70 g/mol |
| Exact Mass | 790.27 |
| IUPAC Name | [2,2-dimethyl-3-(5-methyl-1,3-dioxoisoindol-2-yl)propyl]-[6-[[2,2-dimethyl-3-(5-methyl-1,3-dioxoisoindol-2-yl)propyl]-dimethylazaniumyl]hexyl]-dimethylazanium dibromide |
| SMILES | Cc1ccc2c(c1)C(=O)N(CC(C)(C)C[N+](C)(C)CCCCCC[N+](C)(C)CC(C)(C)CN1C(=O)c3ccc(C)cc3C1=O)C2=O.[Br-].[Br-] |
| InChI | InChI=1S/C38H56N4O4.2BrH/c1-27-15-17-29-31(21-27)35(45)39(33(29)43)23-37(3,4)25-41(7,8)19-13-11-12-14-20-42(9,10)26-38(5,6)24-40-34(44)30-18-16-28(2)22-32(30)36(40)46;;/h15-18,21-22H,11-14,19-20,23-26H2,1-10H3;2*1H/q+2;;/p-2 |
| InChIKey | LUHVXLDRCSBAGD-UHFFFAOYSA-L |
| XLogP | -0.03 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.70 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|