C60H51FN4O3 — CID 10909131
[(1S,2R)-1-hydroxy-2-[2-[(2R)-5,10,15,20-tetraphenyl-2,3,22,24-tetrahydroporphyrin-2-yl]ethyl]cyclohexyl]methyl 4-fluorobenzoate (PubChem CID 10909131) has the molecular formula C60H51FN4O3 and a molecular weight of 895.09 g/mol. Its IUPAC name is [(1S,2R)-1-hydroxy-2-[2-[(2R)-5,10,15,20-tetraphenyl-2,3,22,24-tetrahydroporphyrin-2-yl]ethyl]cyclohexyl]methyl 4-fluorobenzoate.
| Compound Name | [(1S,2R)-1-hydroxy-2-[2-[(2R)-5,10,15,20-tetraphenyl-2,3,22,24-tetrahydroporphyrin-2-yl]ethyl]cyclohexyl]methyl 4-fluorobenzoate |
|---|---|
| PubChem CID | 10909131 |
| Molecular Formula | C60H51FN4O3 |
| Molecular Weight | 895.09 g/mol |
| Exact Mass | 894.39 |
| IUPAC Name | [(1S,2R)-1-hydroxy-2-[2-[(2R)-5,10,15,20-tetraphenyl-2,3,22,24-tetrahydroporphyrin-2-yl]ethyl]cyclohexyl]methyl 4-fluorobenzoate |
| SMILES | O=C(OC[C@]1(O)CCCC[C@@H]1CC[C@@H]1Cc2nc1c(-c1ccccc1)c1ccc([nH]1)c(-c1ccccc1)c1nc(c(-c3ccccc3)c3ccc([nH]3)c2-c2ccccc2)C=C1)c1ccc(F)cc1 |
| InChI | InChI=1S/C60H51FN4O3/c61-46-28-25-43(26-29-46)59(66)68-38-60(67)36-14-13-23-45(60)27-24-44-37-53-56(41-19-9-3-10-20-41)51-33-32-49(63-51)54(39-15-5-1-6-16-39)47-30-31-48(62-47)55(40-17-7-2-8-18-40)50-34-35-52(64-50)57(58(44)65-53)42-21-11-4-12-22-42/h1-12,15-22,25-26,28-35,44-45,63-64,67H,13-14,23-24,27,36-38H2/b54-47-,54-49-,55-48-,55-50-,56-51-,56-53-,57-52-,58-57-/t44-,45-,60-/m1/s1 |
| InChIKey | FPCCCTXTXHPECB-SRDDQRRLSA-N |
| XLogP | 14.18 |
| TPSA | 103.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 895.09 |
| LogP ≤ 5 | 14.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |