C20H16ClN3O2 — CID 109091489
4-N-(4-chlorophenyl)-2-N-methyl-2-N-phenylpyridine-2,4-dicarboxamide (PubChem CID 109091489) has the molecular formula C20H16ClN3O2 and a molecular weight of 365.82 g/mol. Its IUPAC name is 4-N-(4-chlorophenyl)-2-N-methyl-2-N-phenylpyridine-2,4-dicarboxamide.
| Compound Name | 4-N-(4-chlorophenyl)-2-N-methyl-2-N-phenylpyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109091489 |
| Molecular Formula | C20H16ClN3O2 |
| Molecular Weight | 365.82 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 4-N-(4-chlorophenyl)-2-N-methyl-2-N-phenylpyridine-2,4-dicarboxamide |
| SMILES | CN(C(=O)c1cc(C(=O)Nc2ccc(Cl)cc2)ccn1)c1ccccc1 |
| InChI | InChI=1S/C20H16ClN3O2/c1-24(17-5-3-2-4-6-17)20(26)18-13-14(11-12-22-18)19(25)23-16-9-7-15(21)8-10-16/h2-13H,1H3,(H,23,25) |
| InChIKey | PHUGCPQREIBIPZ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.82 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |