C22H21N3O3 — CID 109092376
2-N-ethyl-4-N-(2-methoxyphenyl)-2-N-phenylpyridine-2,4-dicarboxamide (PubChem CID 109092376) has the molecular formula C22H21N3O3 and a molecular weight of 375.43 g/mol. Its IUPAC name is 2-N-ethyl-4-N-(2-methoxyphenyl)-2-N-phenylpyridine-2,4-dicarboxamide.
| Compound Name | 2-N-ethyl-4-N-(2-methoxyphenyl)-2-N-phenylpyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109092376 |
| Molecular Formula | C22H21N3O3 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 2-N-ethyl-4-N-(2-methoxyphenyl)-2-N-phenylpyridine-2,4-dicarboxamide |
| SMILES | CCN(C(=O)c1cc(C(=O)Nc2ccccc2OC)ccn1)c1ccccc1 |
| InChI | InChI=1S/C22H21N3O3/c1-3-25(17-9-5-4-6-10-17)22(27)19-15-16(13-14-23-19)21(26)24-18-11-7-8-12-20(18)28-2/h4-15H,3H2,1-2H3,(H,24,26) |
| InChIKey | CBNQNVHQLNIABD-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |