C16H16N4O2 — CID 109094037
2-N-prop-2-enyl-6-N-(pyridin-3-ylmethyl)pyridine-2,6-dicarboxamide (PubChem CID 109094037) has the molecular formula C16H16N4O2 and a molecular weight of 296.33 g/mol. Its IUPAC name is 2-N-prop-2-enyl-6-N-(pyridin-3-ylmethyl)pyridine-2,6-dicarboxamide.
| Compound Name | 2-N-prop-2-enyl-6-N-(pyridin-3-ylmethyl)pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 109094037 |
| Molecular Formula | C16H16N4O2 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 2-N-prop-2-enyl-6-N-(pyridin-3-ylmethyl)pyridine-2,6-dicarboxamide |
| SMILES | C=CCNC(=O)c1cccc(C(=O)NCc2cccnc2)n1 |
| InChI | InChI=1S/C16H16N4O2/c1-2-8-18-15(21)13-6-3-7-14(20-13)16(22)19-11-12-5-4-9-17-10-12/h2-7,9-10H,1,8,11H2,(H,18,21)(H,19,22) |
| InChIKey | RALMXASHWLQZAQ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|