About N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)ethanesulfonamide
N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)ethanesulfonamide (PubChem CID 1090943) has the molecular formula C9H11N3O3S
and a molecular weight of 241.27 g/mol. Its IUPAC name is N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)ethanesulfonamide.
Molecular Properties
| Compound Name | N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)ethanesulfonamide |
| PubChem CID | 1090943 |
| Molecular Formula | C9H11N3O3S |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)ethanesulfonamide |
| SMILES | CCS(=O)(=O)Nc1ccc2[nH]c(=O)[nH]c2c1 |
| InChI | InChI=1S/C9H11N3O3S/c1-2-16(14,15)12-6-3-4-7-8(5-6)11-9(13)10-7/h3-5,12H,2H2,1H3,(H2,10,11,13) |
| InChIKey | KXVVDIRHDGFMOO-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)ethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)ethanesulfonamide?
The IUPAC name of N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)ethanesulfonamide (CID 1090943) is N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)ethanesulfonamide.
What is the SMILES notation for N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)ethanesulfonamide?
The canonical SMILES for N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)ethanesulfonamide is CCS(=O)(=O)Nc1ccc2[nH]c(=O)[nH]c2c1.
What is the InChIKey of N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)ethanesulfonamide?
The InChIKey is KXVVDIRHDGFMOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3O3S/c1-2-16(14,15)12-6-3-4-7-8(5-6)11-9(13)10-7/h3-5,12H,2H2,1H3,(H2,10,11,13).
What are the key properties of N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)ethanesulfonamide?
N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)ethanesulfonamide has a molecular weight of 241.27 g/mol, XLogP of 0.62, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)ethanesulfonamide is sourced from PubChem (CID 1090943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).