C19H23N3O2 — CID 109094588
6-N-butan-2-yl-2-N-[(2-methylphenyl)methyl]pyridine-2,6-dicarboxamide (PubChem CID 109094588) has the molecular formula C19H23N3O2 and a molecular weight of 325.41 g/mol. Its IUPAC name is 6-N-butan-2-yl-2-N-[(2-methylphenyl)methyl]pyridine-2,6-dicarboxamide.
| Compound Name | 6-N-butan-2-yl-2-N-[(2-methylphenyl)methyl]pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 109094588 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | 6-N-butan-2-yl-2-N-[(2-methylphenyl)methyl]pyridine-2,6-dicarboxamide |
| SMILES | CCC(C)NC(=O)c1cccc(C(=O)NCc2ccccc2C)n1 |
| InChI | InChI=1S/C19H23N3O2/c1-4-14(3)21-19(24)17-11-7-10-16(22-17)18(23)20-12-15-9-6-5-8-13(15)2/h5-11,14H,4,12H2,1-3H3,(H,20,23)(H,21,24) |
| InChIKey | NAVBYPKWPNJXMQ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |