C20H25N3O4 — CID 109094634
6-N-butan-2-yl-2-N-[2-(4-methoxyphenoxy)ethyl]pyridine-2,6-dicarboxamide (PubChem CID 109094634) has the molecular formula C20H25N3O4 and a molecular weight of 371.44 g/mol. Its IUPAC name is 6-N-butan-2-yl-2-N-[2-(4-methoxyphenoxy)ethyl]pyridine-2,6-dicarboxamide.
| Compound Name | 6-N-butan-2-yl-2-N-[2-(4-methoxyphenoxy)ethyl]pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 109094634 |
| Molecular Formula | C20H25N3O4 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | 6-N-butan-2-yl-2-N-[2-(4-methoxyphenoxy)ethyl]pyridine-2,6-dicarboxamide |
| SMILES | CCC(C)NC(=O)c1cccc(C(=O)NCCOc2ccc(OC)cc2)n1 |
| InChI | InChI=1S/C20H25N3O4/c1-4-14(2)22-20(25)18-7-5-6-17(23-18)19(24)21-12-13-27-16-10-8-15(26-3)9-11-16/h5-11,14H,4,12-13H2,1-3H3,(H,21,24)(H,22,25) |
| InChIKey | NIKIYMQRTUHTMN-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|