C8H10O2 — CID 10909631
(1S,5R,7R)-7-methoxybicyclo[3.2.0]hept-2-en-6-one (PubChem CID 10909631) has the molecular formula C8H10O2 and a molecular weight of 138.17 g/mol. Its IUPAC name is (1S,5R,7R)-7-methoxybicyclo[3.2.0]hept-2-en-6-one.
| Compound Name | (1S,5R,7R)-7-methoxybicyclo[3.2.0]hept-2-en-6-one |
|---|---|
| PubChem CID | 10909631 |
| Molecular Formula | C8H10O2 |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.07 |
| IUPAC Name | (1S,5R,7R)-7-methoxybicyclo[3.2.0]hept-2-en-6-one |
| SMILES | CO[C@H]1C(=O)[C@@H]2CC=C[C@@H]21 |
| InChI | InChI=1S/C8H10O2/c1-10-8-6-4-2-3-5(6)7(8)9/h2,4-6,8H,3H2,1H3/t5-,6+,8-/m1/s1 |
| InChIKey | SMBIQUMXORYABC-GKROBHDKSA-N |
| XLogP | 0.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|