About 2-butyl-1,4-dihydroimidazol-5-one
2-butyl-1,4-dihydroimidazol-5-one (PubChem CID 10909654) has the molecular formula C7H12N2O
and a molecular weight of 140.19 g/mol. Its IUPAC name is 2-butyl-1,4-dihydroimidazol-5-one.
Molecular Properties
| Compound Name | 2-butyl-1,4-dihydroimidazol-5-one |
| PubChem CID | 10909654 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | 2-butyl-1,4-dihydroimidazol-5-one |
| SMILES | CCCCC1=NCC(=O)N1 |
| InChI | InChI=1S/C7H12N2O/c1-2-3-4-6-8-5-7(10)9-6/h2-5H2,1H3,(H,8,9,10) |
| InChIKey | BNNOTXZTUYAFBL-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-butyl-1,4-dihydroimidazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-1,4-dihydroimidazol-5-one?
The IUPAC name of 2-butyl-1,4-dihydroimidazol-5-one (CID 10909654) is 2-butyl-1,4-dihydroimidazol-5-one.
What is the SMILES notation for 2-butyl-1,4-dihydroimidazol-5-one?
The canonical SMILES for 2-butyl-1,4-dihydroimidazol-5-one is CCCCC1=NCC(=O)N1.
What is the InChIKey of 2-butyl-1,4-dihydroimidazol-5-one?
The InChIKey is BNNOTXZTUYAFBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O/c1-2-3-4-6-8-5-7(10)9-6/h2-5H2,1H3,(H,8,9,10).
What are the key properties of 2-butyl-1,4-dihydroimidazol-5-one?
2-butyl-1,4-dihydroimidazol-5-one has a molecular weight of 140.19 g/mol, XLogP of 0.70, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-1,4-dihydroimidazol-5-one is sourced from PubChem (CID 10909654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).