C18H13Cl2N3O3 — CID 109097197
6-N-(2,5-dichlorophenyl)-2-N-(furan-2-ylmethyl)pyridine-2,6-dicarboxamide (PubChem CID 109097197) has the molecular formula C18H13Cl2N3O3 and a molecular weight of 390.23 g/mol. Its IUPAC name is 6-N-(2,5-dichlorophenyl)-2-N-(furan-2-ylmethyl)pyridine-2,6-dicarboxamide.
| Compound Name | 6-N-(2,5-dichlorophenyl)-2-N-(furan-2-ylmethyl)pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 109097197 |
| Molecular Formula | C18H13Cl2N3O3 |
| Molecular Weight | 390.23 g/mol |
| Exact Mass | 389.03 |
| IUPAC Name | 6-N-(2,5-dichlorophenyl)-2-N-(furan-2-ylmethyl)pyridine-2,6-dicarboxamide |
| SMILES | O=C(NCc1ccco1)c1cccc(C(=O)Nc2cc(Cl)ccc2Cl)n1 |
| InChI | InChI=1S/C18H13Cl2N3O3/c19-11-6-7-13(20)16(9-11)23-18(25)15-5-1-4-14(22-15)17(24)21-10-12-3-2-8-26-12/h1-9H,10H2,(H,21,24)(H,23,25) |
| InChIKey | FJMBYAAJOJVUKX-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.23 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |