C20H15F2N3O2 — CID 109097324
2-N-benzyl-6-N-(2,6-difluorophenyl)pyridine-2,6-dicarboxamide (PubChem CID 109097324) has the molecular formula C20H15F2N3O2 and a molecular weight of 367.36 g/mol. Its IUPAC name is 2-N-benzyl-6-N-(2,6-difluorophenyl)pyridine-2,6-dicarboxamide.
| Compound Name | 2-N-benzyl-6-N-(2,6-difluorophenyl)pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 109097324 |
| Molecular Formula | C20H15F2N3O2 |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 2-N-benzyl-6-N-(2,6-difluorophenyl)pyridine-2,6-dicarboxamide |
| SMILES | O=C(NCc1ccccc1)c1cccc(C(=O)Nc2c(F)cccc2F)n1 |
| InChI | InChI=1S/C20H15F2N3O2/c21-14-8-4-9-15(22)18(14)25-20(27)17-11-5-10-16(24-17)19(26)23-12-13-6-2-1-3-7-13/h1-11H,12H2,(H,23,26)(H,25,27) |
| InChIKey | WHFMVPXWKKHKBG-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |