About 5-cyclohexyl-1H-pyrazole
5-cyclohexyl-1H-pyrazole (PubChem CID 10909742) has the molecular formula C9H14N2
and a molecular weight of 150.23 g/mol. Its IUPAC name is 5-cyclohexyl-1H-pyrazole.
Molecular Properties
| Compound Name | 5-cyclohexyl-1H-pyrazole |
| PubChem CID | 10909742 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.23 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 5-cyclohexyl-1H-pyrazole |
| SMILES | c1cc(C2CCCCC2)[nH]n1 |
| InChI | InChI=1S/C9H14N2/c1-2-4-8(5-3-1)9-6-7-10-11-9/h6-8H,1-5H2,(H,10,11) |
| InChIKey | RISQWZNRZAZRPJ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.23 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-cyclohexyl-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclohexyl-1H-pyrazole?
The IUPAC name of 5-cyclohexyl-1H-pyrazole (CID 10909742) is 5-cyclohexyl-1H-pyrazole.
What is the SMILES notation for 5-cyclohexyl-1H-pyrazole?
The canonical SMILES for 5-cyclohexyl-1H-pyrazole is c1cc(C2CCCCC2)[nH]n1.
What is the InChIKey of 5-cyclohexyl-1H-pyrazole?
The InChIKey is RISQWZNRZAZRPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2/c1-2-4-8(5-3-1)9-6-7-10-11-9/h6-8H,1-5H2,(H,10,11).
What are the key properties of 5-cyclohexyl-1H-pyrazole?
5-cyclohexyl-1H-pyrazole has a molecular weight of 150.23 g/mol, XLogP of 2.46, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclohexyl-1H-pyrazole is sourced from PubChem (CID 10909742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).