5-(4-hydroxyphenyl)-1,2-oxazole-3-carboxylic acid

C10H7NO4 — CID 1090983

IUPAC5-(4-hydroxyphenyl)-1,2-oxazole-3-carboxylic acid
SMILESO=C(O)c1cc(-c2ccc(O)cc2)on1
InChIInChI=1S/C10H7NO4/c12-7-3-1-6(2-4-7)9-5-8(10(13)14)11-15-9/h1-5,12H,(H,13,14)
InChIKeyPSQJYQJRWKEMEC-UHFFFAOYSA-N
MW205.17 g/mol
LogP1.75
Rot. Bonds2

About 5-(4-hydroxyphenyl)-1,2-oxazole-3-carboxylic acid

5-(4-hydroxyphenyl)-1,2-oxazole-3-carboxylic acid (PubChem CID 1090983) has the molecular formula C10H7NO4 and a molecular weight of 205.17 g/mol. Its IUPAC name is 5-(4-hydroxyphenyl)-1,2-oxazole-3-carboxylic acid.

Molecular Properties

Compound Name5-(4-hydroxyphenyl)-1,2-oxazole-3-carboxylic acid
PubChem CID1090983
Molecular FormulaC10H7NO4
Molecular Weight205.17 g/mol
Exact Mass205.04
IUPAC Name5-(4-hydroxyphenyl)-1,2-oxazole-3-carboxylic acid
SMILESO=C(O)c1cc(-c2ccc(O)cc2)on1
InChIInChI=1S/C10H7NO4/c12-7-3-1-6(2-4-7)9-5-8(10(13)14)11-15-9/h1-5,12H,(H,13,14)
InChIKeyPSQJYQJRWKEMEC-UHFFFAOYSA-N
XLogP1.75
TPSA83.56 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500205.17
LogP ≤ 51.75
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 5-(4-hydroxyphenyl)-1,2-oxazole-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(4-hydroxyphenyl)-1,2-oxazole-3-carboxylic acid?
The IUPAC name of 5-(4-hydroxyphenyl)-1,2-oxazole-3-carboxylic acid (CID 1090983) is 5-(4-hydroxyphenyl)-1,2-oxazole-3-carboxylic acid.
What is the SMILES notation for 5-(4-hydroxyphenyl)-1,2-oxazole-3-carboxylic acid?
The canonical SMILES for 5-(4-hydroxyphenyl)-1,2-oxazole-3-carboxylic acid is O=C(O)c1cc(-c2ccc(O)cc2)on1.
What is the InChIKey of 5-(4-hydroxyphenyl)-1,2-oxazole-3-carboxylic acid?
The InChIKey is PSQJYQJRWKEMEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7NO4/c12-7-3-1-6(2-4-7)9-5-8(10(13)14)11-15-9/h1-5,12H,(H,13,14).
What are the key properties of 5-(4-hydroxyphenyl)-1,2-oxazole-3-carboxylic acid?
5-(4-hydroxyphenyl)-1,2-oxazole-3-carboxylic acid has a molecular weight of 205.17 g/mol, XLogP of 1.75, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-hydroxyphenyl)-1,2-oxazole-3-carboxylic acid is sourced from PubChem (CID 1090983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).