C17H20N4O2 — CID 109098333
6-N-tert-butyl-2-N-(pyridin-4-ylmethyl)pyridine-2,6-dicarboxamide (PubChem CID 109098333) has the molecular formula C17H20N4O2 and a molecular weight of 312.37 g/mol. Its IUPAC name is 6-N-tert-butyl-2-N-(pyridin-4-ylmethyl)pyridine-2,6-dicarboxamide.
| Compound Name | 6-N-tert-butyl-2-N-(pyridin-4-ylmethyl)pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 109098333 |
| Molecular Formula | C17H20N4O2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 6-N-tert-butyl-2-N-(pyridin-4-ylmethyl)pyridine-2,6-dicarboxamide |
| SMILES | CC(C)(C)NC(=O)c1cccc(C(=O)NCc2ccncc2)n1 |
| InChI | InChI=1S/C17H20N4O2/c1-17(2,3)21-16(23)14-6-4-5-13(20-14)15(22)19-11-12-7-9-18-10-8-12/h4-10H,11H2,1-3H3,(H,19,22)(H,21,23) |
| InChIKey | XZHHAKWKCJYZCM-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |