C22H26FN3O2 — CID 109098541
6-(2-ethylpiperidine-1-carbonyl)-N-[2-(2-fluorophenyl)ethyl]pyridine-2-carboxamide (PubChem CID 109098541) has the molecular formula C22H26FN3O2 and a molecular weight of 383.47 g/mol. Its IUPAC name is 6-(2-ethylpiperidine-1-carbonyl)-N-[2-(2-fluorophenyl)ethyl]pyridine-2-carboxamide.
| Compound Name | 6-(2-ethylpiperidine-1-carbonyl)-N-[2-(2-fluorophenyl)ethyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109098541 |
| Molecular Formula | C22H26FN3O2 |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | 6-(2-ethylpiperidine-1-carbonyl)-N-[2-(2-fluorophenyl)ethyl]pyridine-2-carboxamide |
| SMILES | CCC1CCCCN1C(=O)c1cccc(C(=O)NCCc2ccccc2F)n1 |
| InChI | InChI=1S/C22H26FN3O2/c1-2-17-9-5-6-15-26(17)22(28)20-12-7-11-19(25-20)21(27)24-14-13-16-8-3-4-10-18(16)23/h3-4,7-8,10-12,17H,2,5-6,9,13-15H2,1H3,(H,24,27) |
| InChIKey | MIZZTHFPXIVWMM-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |