About 6-(dimethylamino)-2,4-dimethylpyridin-3-ol
6-(dimethylamino)-2,4-dimethylpyridin-3-ol (PubChem CID 10909926) has the molecular formula C9H14N2O
and a molecular weight of 166.22 g/mol. Its IUPAC name is 6-(dimethylamino)-2,4-dimethylpyridin-3-ol.
Molecular Properties
| Compound Name | 6-(dimethylamino)-2,4-dimethylpyridin-3-ol |
| PubChem CID | 10909926 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | 6-(dimethylamino)-2,4-dimethylpyridin-3-ol |
| SMILES | Cc1cc(N(C)C)nc(C)c1O |
| InChI | InChI=1S/C9H14N2O/c1-6-5-8(11(3)4)10-7(2)9(6)12/h5,12H,1-4H3 |
| InChIKey | YNSLTYMSECBVHE-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(dimethylamino)-2,4-dimethylpyridin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(dimethylamino)-2,4-dimethylpyridin-3-ol?
The IUPAC name of 6-(dimethylamino)-2,4-dimethylpyridin-3-ol (CID 10909926) is 6-(dimethylamino)-2,4-dimethylpyridin-3-ol.
What is the SMILES notation for 6-(dimethylamino)-2,4-dimethylpyridin-3-ol?
The canonical SMILES for 6-(dimethylamino)-2,4-dimethylpyridin-3-ol is Cc1cc(N(C)C)nc(C)c1O.
What is the InChIKey of 6-(dimethylamino)-2,4-dimethylpyridin-3-ol?
The InChIKey is YNSLTYMSECBVHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O/c1-6-5-8(11(3)4)10-7(2)9(6)12/h5,12H,1-4H3.
What are the key properties of 6-(dimethylamino)-2,4-dimethylpyridin-3-ol?
6-(dimethylamino)-2,4-dimethylpyridin-3-ol has a molecular weight of 166.22 g/mol, XLogP of 1.47, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(dimethylamino)-2,4-dimethylpyridin-3-ol is sourced from PubChem (CID 10909926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).