About ethyl 1-(3,4-dimethylphenyl)sulfonylpiperidine-4-carboxylate
ethyl 1-(3,4-dimethylphenyl)sulfonylpiperidine-4-carboxylate (PubChem CID 1090993) has the molecular formula C16H23NO4S
and a molecular weight of 325.43 g/mol. Its IUPAC name is ethyl 1-(3,4-dimethylphenyl)sulfonylpiperidine-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-(3,4-dimethylphenyl)sulfonylpiperidine-4-carboxylate |
| PubChem CID | 1090993 |
| Molecular Formula | C16H23NO4S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | ethyl 1-(3,4-dimethylphenyl)sulfonylpiperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(S(=O)(=O)c2ccc(C)c(C)c2)CC1 |
| InChI | InChI=1S/C16H23NO4S/c1-4-21-16(18)14-7-9-17(10-8-14)22(19,20)15-6-5-12(2)13(3)11-15/h5-6,11,14H,4,7-10H2,1-3H3 |
| InChIKey | NECKYNQVUKQFAZ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 1-(3,4-dimethylphenyl)sulfonylpiperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-(3,4-dimethylphenyl)sulfonylpiperidine-4-carboxylate?
The IUPAC name of ethyl 1-(3,4-dimethylphenyl)sulfonylpiperidine-4-carboxylate (CID 1090993) is ethyl 1-(3,4-dimethylphenyl)sulfonylpiperidine-4-carboxylate.
What is the SMILES notation for ethyl 1-(3,4-dimethylphenyl)sulfonylpiperidine-4-carboxylate?
The canonical SMILES for ethyl 1-(3,4-dimethylphenyl)sulfonylpiperidine-4-carboxylate is CCOC(=O)C1CCN(S(=O)(=O)c2ccc(C)c(C)c2)CC1.
What is the InChIKey of ethyl 1-(3,4-dimethylphenyl)sulfonylpiperidine-4-carboxylate?
The InChIKey is NECKYNQVUKQFAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NO4S/c1-4-21-16(18)14-7-9-17(10-8-14)22(19,20)15-6-5-12(2)13(3)11-15/h5-6,11,14H,4,7-10H2,1-3H3.
What are the key properties of ethyl 1-(3,4-dimethylphenyl)sulfonylpiperidine-4-carboxylate?
ethyl 1-(3,4-dimethylphenyl)sulfonylpiperidine-4-carboxylate has a molecular weight of 325.43 g/mol, XLogP of 2.27, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-(3,4-dimethylphenyl)sulfonylpiperidine-4-carboxylate is sourced from PubChem (CID 1090993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).