About 2,4-dichloro-2,4-disilapentane
2,4-dichloro-2,4-disilapentane (PubChem CID 10910047) has the molecular formula C3H8Cl2Si2
and a molecular weight of 171.17 g/mol.
Molecular Properties
| Compound Name | 2,4-dichloro-2,4-disilapentane |
| PubChem CID | 10910047 |
| Molecular Formula | C3H8Cl2Si2 |
| Molecular Weight | 171.17 g/mol |
| Exact Mass | 169.95 |
| IUPAC Name | — |
| SMILES | C[Si](Cl)C[Si](C)Cl |
| InChI | InChI=1S/C3H8Cl2Si2/c1-6(4)3-7(2)5/h3H2,1-2H3 |
| InChIKey | HPHPVQLRCDHHOK-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.17 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dichloro-2,4-disilapentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dichloro-2,4-disilapentane?
The IUPAC name of 2,4-dichloro-2,4-disilapentane (CID 10910047) is not available.
What is the SMILES notation for 2,4-dichloro-2,4-disilapentane?
The canonical SMILES for 2,4-dichloro-2,4-disilapentane is C[Si](Cl)C[Si](C)Cl.
What is the InChIKey of 2,4-dichloro-2,4-disilapentane?
The InChIKey is HPHPVQLRCDHHOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8Cl2Si2/c1-6(4)3-7(2)5/h3H2,1-2H3.
What are the key properties of 2,4-dichloro-2,4-disilapentane?
2,4-dichloro-2,4-disilapentane has a molecular weight of 171.17 g/mol, XLogP of 2.25, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dichloro-2,4-disilapentane is sourced from PubChem (CID 10910047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).