C8H14O2S — CID 10910075
1-[(3R,4S)-4-hydroxythian-3-yl]propan-1-one (PubChem CID 10910075) has the molecular formula C8H14O2S and a molecular weight of 174.26 g/mol. Its IUPAC name is 1-[(3R,4S)-4-hydroxythian-3-yl]propan-1-one.
| Compound Name | 1-[(3R,4S)-4-hydroxythian-3-yl]propan-1-one |
|---|---|
| PubChem CID | 10910075 |
| Molecular Formula | C8H14O2S |
| Molecular Weight | 174.26 g/mol |
| Exact Mass | 174.07 |
| IUPAC Name | 1-[(3R,4S)-4-hydroxythian-3-yl]propan-1-one |
| SMILES | CCC(=O)[C@@H]1CSCC[C@@H]1O |
| InChI | InChI=1S/C8H14O2S/c1-2-7(9)6-5-11-4-3-8(6)10/h6,8,10H,2-5H2,1H3/t6-,8-/m0/s1 |
| InChIKey | MXJVTQHHRVTTRA-XPUUQOCRSA-N |
| XLogP | 1.08 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.26 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |