C17H17N3O2 — CID 109101805
5-N-(2-methylphenyl)-3-N-prop-2-enylpyridine-3,5-dicarboxamide (PubChem CID 109101805) has the molecular formula C17H17N3O2 and a molecular weight of 295.34 g/mol. Its IUPAC name is 5-N-(2-methylphenyl)-3-N-prop-2-enylpyridine-3,5-dicarboxamide.
| Compound Name | 5-N-(2-methylphenyl)-3-N-prop-2-enylpyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 109101805 |
| Molecular Formula | C17H17N3O2 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | 5-N-(2-methylphenyl)-3-N-prop-2-enylpyridine-3,5-dicarboxamide |
| SMILES | C=CCNC(=O)c1cncc(C(=O)Nc2ccccc2C)c1 |
| InChI | InChI=1S/C17H17N3O2/c1-3-8-19-16(21)13-9-14(11-18-10-13)17(22)20-15-7-5-4-6-12(15)2/h3-7,9-11H,1,8H2,2H3,(H,19,21)(H,20,22) |
| InChIKey | CPGOFKIRLIEREH-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|