propan-2-yl 4-methyl-3,6-dihydro-2H-pyran-2-carboxylate

C10H16O3 — CID 10910218

IUPACpropan-2-yl 4-methyl-3,6-dihydro-2H-pyran-2-carboxylate
SMILESCC1=CCOC(C(=O)OC(C)C)C1
InChIInChI=1S/C10H16O3/c1-7(2)13-10(11)9-6-8(3)4-5-12-9/h4,7,9H,5-6H2,1-3H3
InChIKeyFEVBUXGYWNHLSB-UHFFFAOYSA-N
MW184.23 g/mol
LogP1.67
Rot. Bonds2

About propan-2-yl 4-methyl-3,6-dihydro-2H-pyran-2-carboxylate

propan-2-yl 4-methyl-3,6-dihydro-2H-pyran-2-carboxylate (PubChem CID 10910218) has the molecular formula C10H16O3 and a molecular weight of 184.23 g/mol. Its IUPAC name is propan-2-yl 4-methyl-3,6-dihydro-2H-pyran-2-carboxylate.

Molecular Properties

Compound Namepropan-2-yl 4-methyl-3,6-dihydro-2H-pyran-2-carboxylate
PubChem CID10910218
Molecular FormulaC10H16O3
Molecular Weight184.23 g/mol
Exact Mass184.11
IUPAC Namepropan-2-yl 4-methyl-3,6-dihydro-2H-pyran-2-carboxylate
SMILESCC1=CCOC(C(=O)OC(C)C)C1
InChIInChI=1S/C10H16O3/c1-7(2)13-10(11)9-6-8(3)4-5-12-9/h4,7,9H,5-6H2,1-3H3
InChIKeyFEVBUXGYWNHLSB-UHFFFAOYSA-N
XLogP1.67
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500184.23
LogP ≤ 51.67
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze propan-2-yl 4-methyl-3,6-dihydro-2H-pyran-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of propan-2-yl 4-methyl-3,6-dihydro-2H-pyran-2-carboxylate?
The IUPAC name of propan-2-yl 4-methyl-3,6-dihydro-2H-pyran-2-carboxylate (CID 10910218) is propan-2-yl 4-methyl-3,6-dihydro-2H-pyran-2-carboxylate.
What is the SMILES notation for propan-2-yl 4-methyl-3,6-dihydro-2H-pyran-2-carboxylate?
The canonical SMILES for propan-2-yl 4-methyl-3,6-dihydro-2H-pyran-2-carboxylate is CC1=CCOC(C(=O)OC(C)C)C1.
What is the InChIKey of propan-2-yl 4-methyl-3,6-dihydro-2H-pyran-2-carboxylate?
The InChIKey is FEVBUXGYWNHLSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O3/c1-7(2)13-10(11)9-6-8(3)4-5-12-9/h4,7,9H,5-6H2,1-3H3.
What are the key properties of propan-2-yl 4-methyl-3,6-dihydro-2H-pyran-2-carboxylate?
propan-2-yl 4-methyl-3,6-dihydro-2H-pyran-2-carboxylate has a molecular weight of 184.23 g/mol, XLogP of 1.67, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 4-methyl-3,6-dihydro-2H-pyran-2-carboxylate is sourced from PubChem (CID 10910218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).