About (3S)-3-amino-3,5-dihydro-2H-1,5-benzothiazepin-4-one
(3S)-3-amino-3,5-dihydro-2H-1,5-benzothiazepin-4-one (PubChem CID 10910414) has the molecular formula C9H10N2OS
and a molecular weight of 194.26 g/mol. Its IUPAC name is (3S)-3-amino-3,5-dihydro-2H-1,5-benzothiazepin-4-one.
Molecular Properties
| Compound Name | (3S)-3-amino-3,5-dihydro-2H-1,5-benzothiazepin-4-one |
| PubChem CID | 10910414 |
| Molecular Formula | C9H10N2OS |
| Molecular Weight | 194.26 g/mol |
| Exact Mass | 194.05 |
| IUPAC Name | (3S)-3-amino-3,5-dihydro-2H-1,5-benzothiazepin-4-one |
| SMILES | N[C@@H]1CSc2ccccc2NC1=O |
| InChI | InChI=1S/C9H10N2OS/c10-6-5-13-8-4-2-1-3-7(8)11-9(6)12/h1-4,6H,5,10H2,(H,11,12)/t6-/m1/s1 |
| InChIKey | CVTKHBONQJBXKR-ZCFIWIBFSA-N |
| XLogP | 1.06 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.26 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S)-3-amino-3,5-dihydro-2H-1,5-benzothiazepin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-amino-3,5-dihydro-2H-1,5-benzothiazepin-4-one?
The IUPAC name of (3S)-3-amino-3,5-dihydro-2H-1,5-benzothiazepin-4-one (CID 10910414) is (3S)-3-amino-3,5-dihydro-2H-1,5-benzothiazepin-4-one.
What is the SMILES notation for (3S)-3-amino-3,5-dihydro-2H-1,5-benzothiazepin-4-one?
The canonical SMILES for (3S)-3-amino-3,5-dihydro-2H-1,5-benzothiazepin-4-one is N[C@@H]1CSc2ccccc2NC1=O.
What is the InChIKey of (3S)-3-amino-3,5-dihydro-2H-1,5-benzothiazepin-4-one?
The InChIKey is CVTKHBONQJBXKR-ZCFIWIBFSA-N. The full InChI is InChI=1S/C9H10N2OS/c10-6-5-13-8-4-2-1-3-7(8)11-9(6)12/h1-4,6H,5,10H2,(H,11,12)/t6-/m1/s1.
What are the key properties of (3S)-3-amino-3,5-dihydro-2H-1,5-benzothiazepin-4-one?
(3S)-3-amino-3,5-dihydro-2H-1,5-benzothiazepin-4-one has a molecular weight of 194.26 g/mol, XLogP of 1.06, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-amino-3,5-dihydro-2H-1,5-benzothiazepin-4-one is sourced from PubChem (CID 10910414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).