C11H16O3 — CID 10910455
(1S,3aS,6aR)-1-methylspiro[1,3,3a,4,6,6a-hexahydropentalene-5,2'-1,3-dioxolane]-2-one (PubChem CID 10910455) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is (1S,3aS,6aR)-1-methylspiro[1,3,3a,4,6,6a-hexahydropentalene-5,2'-1,3-dioxolane]-2-one.
| Compound Name | (1S,3aS,6aR)-1-methylspiro[1,3,3a,4,6,6a-hexahydropentalene-5,2'-1,3-dioxolane]-2-one |
|---|---|
| PubChem CID | 10910455 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | (1S,3aS,6aR)-1-methylspiro[1,3,3a,4,6,6a-hexahydropentalene-5,2'-1,3-dioxolane]-2-one |
| SMILES | C[C@@H]1C(=O)C[C@H]2CC3(C[C@H]21)OCCO3 |
| InChI | InChI=1S/C11H16O3/c1-7-9-6-11(13-2-3-14-11)5-8(9)4-10(7)12/h7-9H,2-6H2,1H3/t7-,8-,9-/m0/s1 |
| InChIKey | TYCWWTJEMCJUJR-CIUDSAMLSA-N |
| XLogP | 1.36 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |