C18H16N4O3 — CID 109105083
3-N-benzyl-5-N-(5-methyl-1,2-oxazol-3-yl)pyridine-3,5-dicarboxamide (PubChem CID 109105083) has the molecular formula C18H16N4O3 and a molecular weight of 336.35 g/mol. Its IUPAC name is 3-N-benzyl-5-N-(5-methyl-1,2-oxazol-3-yl)pyridine-3,5-dicarboxamide.
| Compound Name | 3-N-benzyl-5-N-(5-methyl-1,2-oxazol-3-yl)pyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 109105083 |
| Molecular Formula | C18H16N4O3 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 3-N-benzyl-5-N-(5-methyl-1,2-oxazol-3-yl)pyridine-3,5-dicarboxamide |
| SMILES | Cc1cc(NC(=O)c2cncc(C(=O)NCc3ccccc3)c2)no1 |
| InChI | InChI=1S/C18H16N4O3/c1-12-7-16(22-25-12)21-18(24)15-8-14(10-19-11-15)17(23)20-9-13-5-3-2-4-6-13/h2-8,10-11H,9H2,1H3,(H,20,23)(H,21,22,24) |
| InChIKey | LEZUKLKQCVWMNH-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |