C12H24S — CID 10910550
(3S,4S,5S)-3,4-dimethyl-5-methylsulfanylnon-1-ene (PubChem CID 10910550) has the molecular formula C12H24S and a molecular weight of 200.39 g/mol. Its IUPAC name is (3S,4S,5S)-3,4-dimethyl-5-methylsulfanylnon-1-ene.
| Compound Name | (3S,4S,5S)-3,4-dimethyl-5-methylsulfanylnon-1-ene |
|---|---|
| PubChem CID | 10910550 |
| Molecular Formula | C12H24S |
| Molecular Weight | 200.39 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | (3S,4S,5S)-3,4-dimethyl-5-methylsulfanylnon-1-ene |
| SMILES | C=C[C@H](C)[C@H](C)[C@H](CCCC)SC |
| InChI | InChI=1S/C12H24S/c1-6-8-9-12(13-5)11(4)10(3)7-2/h7,10-12H,2,6,8-9H2,1,3-5H3/t10-,11-,12-/m0/s1 |
| InChIKey | INAIIUCAXNKNPU-SRVKXCTJSA-N |
| XLogP | 4.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.39 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|