C18H22N4O2 — CID 109105911
3-N-pentyl-5-N-(pyridin-2-ylmethyl)pyridine-3,5-dicarboxamide (PubChem CID 109105911) has the molecular formula C18H22N4O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is 3-N-pentyl-5-N-(pyridin-2-ylmethyl)pyridine-3,5-dicarboxamide.
| Compound Name | 3-N-pentyl-5-N-(pyridin-2-ylmethyl)pyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 109105911 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 3-N-pentyl-5-N-(pyridin-2-ylmethyl)pyridine-3,5-dicarboxamide |
| SMILES | CCCCCNC(=O)c1cncc(C(=O)NCc2ccccn2)c1 |
| InChI | InChI=1S/C18H22N4O2/c1-2-3-5-9-21-17(23)14-10-15(12-19-11-14)18(24)22-13-16-7-4-6-8-20-16/h4,6-8,10-12H,2-3,5,9,13H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | NXIMQMAKZFFQJG-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|