C19H23N3O4 — CID 109106788
3-N-(2,5-dimethoxyphenyl)-5-N,5-N-diethylpyridine-3,5-dicarboxamide (PubChem CID 109106788) has the molecular formula C19H23N3O4 and a molecular weight of 357.41 g/mol. Its IUPAC name is 3-N-(2,5-dimethoxyphenyl)-5-N,5-N-diethylpyridine-3,5-dicarboxamide.
| Compound Name | 3-N-(2,5-dimethoxyphenyl)-5-N,5-N-diethylpyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 109106788 |
| Molecular Formula | C19H23N3O4 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 3-N-(2,5-dimethoxyphenyl)-5-N,5-N-diethylpyridine-3,5-dicarboxamide |
| SMILES | CCN(CC)C(=O)c1cncc(C(=O)Nc2cc(OC)ccc2OC)c1 |
| InChI | InChI=1S/C19H23N3O4/c1-5-22(6-2)19(24)14-9-13(11-20-12-14)18(23)21-16-10-15(25-3)7-8-17(16)26-4/h7-12H,5-6H2,1-4H3,(H,21,23) |
| InChIKey | JYCKOFYWARXNNO-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |