C18H20ClN3O3 — CID 109106946
5-N-tert-butyl-3-N-(5-chloro-2-methoxyphenyl)pyridine-3,5-dicarboxamide (PubChem CID 109106946) has the molecular formula C18H20ClN3O3 and a molecular weight of 361.83 g/mol. Its IUPAC name is 5-N-tert-butyl-3-N-(5-chloro-2-methoxyphenyl)pyridine-3,5-dicarboxamide.
| Compound Name | 5-N-tert-butyl-3-N-(5-chloro-2-methoxyphenyl)pyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 109106946 |
| Molecular Formula | C18H20ClN3O3 |
| Molecular Weight | 361.83 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | 5-N-tert-butyl-3-N-(5-chloro-2-methoxyphenyl)pyridine-3,5-dicarboxamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)c1cncc(C(=O)NC(C)(C)C)c1 |
| InChI | InChI=1S/C18H20ClN3O3/c1-18(2,3)22-17(24)12-7-11(9-20-10-12)16(23)21-14-8-13(19)5-6-15(14)25-4/h5-10H,1-4H3,(H,21,23)(H,22,24) |
| InChIKey | WZROMPPEZSZLCN-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.83 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |