C18H19Cl2N3O2 — CID 109107296
5-N-(2,4-dichlorophenyl)-3-N-pentylpyridine-3,5-dicarboxamide (PubChem CID 109107296) has the molecular formula C18H19Cl2N3O2 and a molecular weight of 380.28 g/mol. Its IUPAC name is 5-N-(2,4-dichlorophenyl)-3-N-pentylpyridine-3,5-dicarboxamide.
| Compound Name | 5-N-(2,4-dichlorophenyl)-3-N-pentylpyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 109107296 |
| Molecular Formula | C18H19Cl2N3O2 |
| Molecular Weight | 380.28 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | 5-N-(2,4-dichlorophenyl)-3-N-pentylpyridine-3,5-dicarboxamide |
| SMILES | CCCCCNC(=O)c1cncc(C(=O)Nc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C18H19Cl2N3O2/c1-2-3-4-7-22-17(24)12-8-13(11-21-10-12)18(25)23-16-6-5-14(19)9-15(16)20/h5-6,8-11H,2-4,7H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | ROAYWNPKNWDLIY-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.28 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|