C21H25N3O4 — CID 109107303
ethyl 2-[[5-(pentylcarbamoyl)pyridine-3-carbonyl]amino]benzoate (PubChem CID 109107303) has the molecular formula C21H25N3O4 and a molecular weight of 383.45 g/mol. Its IUPAC name is ethyl 2-[[5-(pentylcarbamoyl)pyridine-3-carbonyl]amino]benzoate.
| Compound Name | ethyl 2-[[5-(pentylcarbamoyl)pyridine-3-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 109107303 |
| Molecular Formula | C21H25N3O4 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | ethyl 2-[[5-(pentylcarbamoyl)pyridine-3-carbonyl]amino]benzoate |
| SMILES | CCCCCNC(=O)c1cncc(C(=O)Nc2ccccc2C(=O)OCC)c1 |
| InChI | InChI=1S/C21H25N3O4/c1-3-5-8-11-23-19(25)15-12-16(14-22-13-15)20(26)24-18-10-7-6-9-17(18)21(27)28-4-2/h6-7,9-10,12-14H,3-5,8,11H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | WECTVNJBCZZWQB-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|