C20H25N3O2 — CID 109107334
3-N-butyl-5-N-ethyl-3-N-methyl-5-N-phenylpyridine-3,5-dicarboxamide (PubChem CID 109107334) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is 3-N-butyl-5-N-ethyl-3-N-methyl-5-N-phenylpyridine-3,5-dicarboxamide.
| Compound Name | 3-N-butyl-5-N-ethyl-3-N-methyl-5-N-phenylpyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 109107334 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | 3-N-butyl-5-N-ethyl-3-N-methyl-5-N-phenylpyridine-3,5-dicarboxamide |
| SMILES | CCCCN(C)C(=O)c1cncc(C(=O)N(CC)c2ccccc2)c1 |
| InChI | InChI=1S/C20H25N3O2/c1-4-6-12-22(3)19(24)16-13-17(15-21-14-16)20(25)23(5-2)18-10-8-7-9-11-18/h7-11,13-15H,4-6,12H2,1-3H3 |
| InChIKey | UVXLPQYKZSHNIX-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |