C11H12O4 — CID 10910734
(6aS,9aS,9bS)-3,4,6,6a,9a,9b-hexahydro-2H-furo[3,4-h]chromene-7,9-dione (PubChem CID 10910734) has the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. Its IUPAC name is (6aS,9aS,9bS)-3,4,6,6a,9a,9b-hexahydro-2H-furo[3,4-h]chromene-7,9-dione.
| Compound Name | (6aS,9aS,9bS)-3,4,6,6a,9a,9b-hexahydro-2H-furo[3,4-h]chromene-7,9-dione |
|---|---|
| PubChem CID | 10910734 |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | (6aS,9aS,9bS)-3,4,6,6a,9a,9b-hexahydro-2H-furo[3,4-h]chromene-7,9-dione |
| SMILES | O=C1OC(=O)[C@H]2CC=C3CCCO[C@H]3[C@@H]12 |
| InChI | InChI=1S/C11H12O4/c12-10-7-4-3-6-2-1-5-14-9(6)8(7)11(13)15-10/h3,7-9H,1-2,4-5H2/t7-,8-,9+/m0/s1 |
| InChIKey | TUAFSPAHMXXVQY-XHNCKOQMSA-N |
| XLogP | 0.81 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|