C8H16O4S — CID 10910755
(2R,3S,4R,5S,6S)-2-ethylsulfanyl-6-methyloxane-3,4,5-triol (PubChem CID 10910755) has the molecular formula C8H16O4S and a molecular weight of 208.28 g/mol. Its IUPAC name is (2R,3S,4R,5S,6S)-2-ethylsulfanyl-6-methyloxane-3,4,5-triol.
| Compound Name | (2R,3S,4R,5S,6S)-2-ethylsulfanyl-6-methyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 10910755 |
| Molecular Formula | C8H16O4S |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | (2R,3S,4R,5S,6S)-2-ethylsulfanyl-6-methyloxane-3,4,5-triol |
| SMILES | CCS[C@H]1O[C@@H](C)[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C8H16O4S/c1-3-13-8-7(11)6(10)5(9)4(2)12-8/h4-11H,3H2,1-2H3/t4-,5+,6+,7-,8+/m0/s1 |
| InChIKey | FFRRGRSSCFQGAP-FMGWEMOISA-N |
| XLogP | -0.43 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |