About 6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidin-2-amine
6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidin-2-amine (PubChem CID 10910771) has the molecular formula C6H8N4
and a molecular weight of 136.16 g/mol. Its IUPAC name is 6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidin-2-amine.
Molecular Properties
| Compound Name | 6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidin-2-amine |
| PubChem CID | 10910771 |
| Molecular Formula | C6H8N4 |
| Molecular Weight | 136.16 g/mol |
| Exact Mass | 136.07 |
| IUPAC Name | 6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidin-2-amine |
| SMILES | Nc1ncc2c(n1)CNC2 |
| InChI | InChI=1S/C6H8N4/c7-6-9-2-4-1-8-3-5(4)10-6/h2,8H,1,3H2,(H2,7,9,10) |
| InChIKey | BNKWCEZPRJODQK-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.16 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidin-2-amine?
The IUPAC name of 6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidin-2-amine (CID 10910771) is 6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidin-2-amine.
What is the SMILES notation for 6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidin-2-amine?
The canonical SMILES for 6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidin-2-amine is Nc1ncc2c(n1)CNC2.
What is the InChIKey of 6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidin-2-amine?
The InChIKey is BNKWCEZPRJODQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N4/c7-6-9-2-4-1-8-3-5(4)10-6/h2,8H,1,3H2,(H2,7,9,10).
What are the key properties of 6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidin-2-amine?
6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidin-2-amine has a molecular weight of 136.16 g/mol, XLogP of -0.34, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidin-2-amine is sourced from PubChem (CID 10910771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).