C19H14ClN3O2 — CID 109107777
5-N-(2-chlorophenyl)-3-N-phenylpyridine-3,5-dicarboxamide (PubChem CID 109107777) has the molecular formula C19H14ClN3O2 and a molecular weight of 351.79 g/mol. Its IUPAC name is 5-N-(2-chlorophenyl)-3-N-phenylpyridine-3,5-dicarboxamide.
| Compound Name | 5-N-(2-chlorophenyl)-3-N-phenylpyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 109107777 |
| Molecular Formula | C19H14ClN3O2 |
| Molecular Weight | 351.79 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 5-N-(2-chlorophenyl)-3-N-phenylpyridine-3,5-dicarboxamide |
| SMILES | O=C(Nc1ccccc1)c1cncc(C(=O)Nc2ccccc2Cl)c1 |
| InChI | InChI=1S/C19H14ClN3O2/c20-16-8-4-5-9-17(16)23-19(25)14-10-13(11-21-12-14)18(24)22-15-6-2-1-3-7-15/h1-12H,(H,22,24)(H,23,25) |
| InChIKey | ZLPJZHVQHHODKA-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.79 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |