C9H15N3O3 — CID 10910872
1,5-dimethyl-5-(propan-2-ylamino)-1,3-diazinane-2,4,6-trione (PubChem CID 10910872) has the molecular formula C9H15N3O3 and a molecular weight of 213.24 g/mol. Its IUPAC name is 1,5-dimethyl-5-(propan-2-ylamino)-1,3-diazinane-2,4,6-trione.
| Compound Name | 1,5-dimethyl-5-(propan-2-ylamino)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 10910872 |
| Molecular Formula | C9H15N3O3 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.11 |
| IUPAC Name | 1,5-dimethyl-5-(propan-2-ylamino)-1,3-diazinane-2,4,6-trione |
| SMILES | CC(C)NC1(C)C(=O)NC(=O)N(C)C1=O |
| InChI | InChI=1S/C9H15N3O3/c1-5(2)11-9(3)6(13)10-8(15)12(4)7(9)14/h5,11H,1-4H3,(H,10,13,15) |
| InChIKey | FVQXDJAMZGAYRE-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|