C11H16N4O — CID 109109200
6-(cyclopropylamino)-N-propylpyridazine-3-carboxamide (PubChem CID 109109200) has the molecular formula C11H16N4O and a molecular weight of 220.28 g/mol. Its IUPAC name is 6-(cyclopropylamino)-N-propylpyridazine-3-carboxamide.
| Compound Name | 6-(cyclopropylamino)-N-propylpyridazine-3-carboxamide |
|---|---|
| PubChem CID | 109109200 |
| Molecular Formula | C11H16N4O |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 6-(cyclopropylamino)-N-propylpyridazine-3-carboxamide |
| SMILES | CCCNC(=O)c1ccc(NC2CC2)nn1 |
| InChI | InChI=1S/C11H16N4O/c1-2-7-12-11(16)9-5-6-10(15-14-9)13-8-3-4-8/h5-6,8H,2-4,7H2,1H3,(H,12,16)(H,13,15) |
| InChIKey | OXYZTNBDSJUMML-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |