About [(E)-4,4,4-trifluorobut-2-enoxy]methylbenzene
[(E)-4,4,4-trifluorobut-2-enoxy]methylbenzene (PubChem CID 10910927) has the molecular formula C11H11F3O
and a molecular weight of 216.20 g/mol. Its IUPAC name is [(E)-4,4,4-trifluorobut-2-enoxy]methylbenzene.
Molecular Properties
| Compound Name | [(E)-4,4,4-trifluorobut-2-enoxy]methylbenzene |
| PubChem CID | 10910927 |
| Molecular Formula | C11H11F3O |
| Molecular Weight | 216.20 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | [(E)-4,4,4-trifluorobut-2-enoxy]methylbenzene |
| SMILES | FC(F)(F)/C=C/COCc1ccccc1 |
| InChI | InChI=1S/C11H11F3O/c12-11(13,14)7-4-8-15-9-10-5-2-1-3-6-10/h1-7H,8-9H2/b7-4+ |
| InChIKey | LISBATGHZDMSIS-QPJJXVBHSA-N |
| XLogP | 3.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.20 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(E)-4,4,4-trifluorobut-2-enoxy]methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-4,4,4-trifluorobut-2-enoxy]methylbenzene?
The IUPAC name of [(E)-4,4,4-trifluorobut-2-enoxy]methylbenzene (CID 10910927) is [(E)-4,4,4-trifluorobut-2-enoxy]methylbenzene.
What is the SMILES notation for [(E)-4,4,4-trifluorobut-2-enoxy]methylbenzene?
The canonical SMILES for [(E)-4,4,4-trifluorobut-2-enoxy]methylbenzene is FC(F)(F)/C=C/COCc1ccccc1.
What is the InChIKey of [(E)-4,4,4-trifluorobut-2-enoxy]methylbenzene?
The InChIKey is LISBATGHZDMSIS-QPJJXVBHSA-N. The full InChI is InChI=1S/C11H11F3O/c12-11(13,14)7-4-8-15-9-10-5-2-1-3-6-10/h1-7H,8-9H2/b7-4+.
What are the key properties of [(E)-4,4,4-trifluorobut-2-enoxy]methylbenzene?
[(E)-4,4,4-trifluorobut-2-enoxy]methylbenzene has a molecular weight of 216.20 g/mol, XLogP of 3.32, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-4,4,4-trifluorobut-2-enoxy]methylbenzene is sourced from PubChem (CID 10910927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).