About ethoxycarbonyl octanoate
ethoxycarbonyl octanoate (PubChem CID 10910940) has the molecular formula C11H20O4
and a molecular weight of 216.28 g/mol. Its IUPAC name is ethoxycarbonyl octanoate.
Molecular Properties
| Compound Name | ethoxycarbonyl octanoate |
| PubChem CID | 10910940 |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | ethoxycarbonyl octanoate |
| SMILES | CCCCCCCC(=O)OC(=O)OCC |
| InChI | InChI=1S/C11H20O4/c1-3-5-6-7-8-9-10(12)15-11(13)14-4-2/h3-9H2,1-2H3 |
| InChIKey | AUEVYYBZJPZXPR-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ethoxycarbonyl octanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethoxycarbonyl octanoate?
The IUPAC name of ethoxycarbonyl octanoate (CID 10910940) is ethoxycarbonyl octanoate.
What is the SMILES notation for ethoxycarbonyl octanoate?
The canonical SMILES for ethoxycarbonyl octanoate is CCCCCCCC(=O)OC(=O)OCC.
What is the InChIKey of ethoxycarbonyl octanoate?
The InChIKey is AUEVYYBZJPZXPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O4/c1-3-5-6-7-8-9-10(12)15-11(13)14-4-2/h3-9H2,1-2H3.
What are the key properties of ethoxycarbonyl octanoate?
ethoxycarbonyl octanoate has a molecular weight of 216.28 g/mol, XLogP of 3.05, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethoxycarbonyl octanoate is sourced from PubChem (CID 10910940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).