C17H21ClN4O — CID 109110630
6-(butylamino)-N-[2-(4-chlorophenyl)ethyl]pyridazine-3-carboxamide (PubChem CID 109110630) has the molecular formula C17H21ClN4O and a molecular weight of 332.84 g/mol. Its IUPAC name is 6-(butylamino)-N-[2-(4-chlorophenyl)ethyl]pyridazine-3-carboxamide.
| Compound Name | 6-(butylamino)-N-[2-(4-chlorophenyl)ethyl]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 109110630 |
| Molecular Formula | C17H21ClN4O |
| Molecular Weight | 332.84 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 6-(butylamino)-N-[2-(4-chlorophenyl)ethyl]pyridazine-3-carboxamide |
| SMILES | CCCCNc1ccc(C(=O)NCCc2ccc(Cl)cc2)nn1 |
| InChI | InChI=1S/C17H21ClN4O/c1-2-3-11-19-16-9-8-15(21-22-16)17(23)20-12-10-13-4-6-14(18)7-5-13/h4-9H,2-3,10-12H2,1H3,(H,19,22)(H,20,23) |
| InChIKey | NPYSSYBZLGXQEH-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.84 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|