C14H20O2 — CID 10911086
(1E,4E)-1-hydroxy-5-(2,6,6-trimethylcyclohex-2-en-1-yl)penta-1,4-dien-3-one (PubChem CID 10911086) has the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. Its IUPAC name is (1E,4E)-1-hydroxy-5-(2,6,6-trimethylcyclohex-2-en-1-yl)penta-1,4-dien-3-one.
| Compound Name | (1E,4E)-1-hydroxy-5-(2,6,6-trimethylcyclohex-2-en-1-yl)penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 10911086 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | (1E,4E)-1-hydroxy-5-(2,6,6-trimethylcyclohex-2-en-1-yl)penta-1,4-dien-3-one |
| SMILES | CC1=CCCC(C)(C)C1/C=C/C(=O)/C=C/O |
| InChI | InChI=1S/C14H20O2/c1-11-5-4-9-14(2,3)13(11)7-6-12(16)8-10-15/h5-8,10,13,15H,4,9H2,1-3H3/b7-6+,10-8+ |
| InChIKey | RWGGNECQGKKGCQ-LQPGMRSMSA-N |
| XLogP | 3.57 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|