C16H17N5O — CID 109110955
N-butyl-6-(4-cyanoanilino)pyridazine-3-carboxamide (PubChem CID 109110955) has the molecular formula C16H17N5O and a molecular weight of 295.35 g/mol. Its IUPAC name is N-butyl-6-(4-cyanoanilino)pyridazine-3-carboxamide.
| Compound Name | N-butyl-6-(4-cyanoanilino)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 109110955 |
| Molecular Formula | C16H17N5O |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | N-butyl-6-(4-cyanoanilino)pyridazine-3-carboxamide |
| SMILES | CCCCNC(=O)c1ccc(Nc2ccc(C#N)cc2)nn1 |
| InChI | InChI=1S/C16H17N5O/c1-2-3-10-18-16(22)14-8-9-15(21-20-14)19-13-6-4-12(11-17)5-7-13/h4-9H,2-3,10H2,1H3,(H,18,22)(H,19,21) |
| InChIKey | FESSFXMFMLIPTN-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|