About (2E)-2-(5-chloro-2,3-dihydroinden-1-ylidene)-N-methylacetamide
(2E)-2-(5-chloro-2,3-dihydroinden-1-ylidene)-N-methylacetamide (PubChem CID 10911115) has the molecular formula C12H12ClNO
and a molecular weight of 221.69 g/mol. Its IUPAC name is (2E)-2-(5-chloro-2,3-dihydroinden-1-ylidene)-N-methylacetamide.
Molecular Properties
| Compound Name | (2E)-2-(5-chloro-2,3-dihydroinden-1-ylidene)-N-methylacetamide |
| PubChem CID | 10911115 |
| Molecular Formula | C12H12ClNO |
| Molecular Weight | 221.69 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | (2E)-2-(5-chloro-2,3-dihydroinden-1-ylidene)-N-methylacetamide |
| SMILES | CNC(=O)/C=C1\CCc2cc(Cl)ccc21 |
| InChI | InChI=1S/C12H12ClNO/c1-14-12(15)7-9-3-2-8-6-10(13)4-5-11(8)9/h4-7H,2-3H2,1H3,(H,14,15)/b9-7+ |
| InChIKey | LUFGZAOTMGGHLU-VQHVLOKHSA-N |
| XLogP | 2.42 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.69 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-(5-chloro-2,3-dihydroinden-1-ylidene)-N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-(5-chloro-2,3-dihydroinden-1-ylidene)-N-methylacetamide?
The IUPAC name of (2E)-2-(5-chloro-2,3-dihydroinden-1-ylidene)-N-methylacetamide (CID 10911115) is (2E)-2-(5-chloro-2,3-dihydroinden-1-ylidene)-N-methylacetamide.
What is the SMILES notation for (2E)-2-(5-chloro-2,3-dihydroinden-1-ylidene)-N-methylacetamide?
The canonical SMILES for (2E)-2-(5-chloro-2,3-dihydroinden-1-ylidene)-N-methylacetamide is CNC(=O)/C=C1\CCc2cc(Cl)ccc21.
What is the InChIKey of (2E)-2-(5-chloro-2,3-dihydroinden-1-ylidene)-N-methylacetamide?
The InChIKey is LUFGZAOTMGGHLU-VQHVLOKHSA-N. The full InChI is InChI=1S/C12H12ClNO/c1-14-12(15)7-9-3-2-8-6-10(13)4-5-11(8)9/h4-7H,2-3H2,1H3,(H,14,15)/b9-7+.
What are the key properties of (2E)-2-(5-chloro-2,3-dihydroinden-1-ylidene)-N-methylacetamide?
(2E)-2-(5-chloro-2,3-dihydroinden-1-ylidene)-N-methylacetamide has a molecular weight of 221.69 g/mol, XLogP of 2.42, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-(5-chloro-2,3-dihydroinden-1-ylidene)-N-methylacetamide is sourced from PubChem (CID 10911115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).