C14H24N4O — CID 109111229
6-(3-methylbutylamino)-N-(2-methylpropyl)pyridazine-3-carboxamide (PubChem CID 109111229) has the molecular formula C14H24N4O and a molecular weight of 264.37 g/mol. Its IUPAC name is 6-(3-methylbutylamino)-N-(2-methylpropyl)pyridazine-3-carboxamide.
| Compound Name | 6-(3-methylbutylamino)-N-(2-methylpropyl)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 109111229 |
| Molecular Formula | C14H24N4O |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.20 |
| IUPAC Name | 6-(3-methylbutylamino)-N-(2-methylpropyl)pyridazine-3-carboxamide |
| SMILES | CC(C)CCNc1ccc(C(=O)NCC(C)C)nn1 |
| InChI | InChI=1S/C14H24N4O/c1-10(2)7-8-15-13-6-5-12(17-18-13)14(19)16-9-11(3)4/h5-6,10-11H,7-9H2,1-4H3,(H,15,18)(H,16,19) |
| InChIKey | YTYDISOYQJFLRY-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |