C8H8F3NO3 — CID 10911161
1-methyl-3-(2,2,2-trifluoro-1,1-dihydroxyethyl)pyridin-2-one (PubChem CID 10911161) has the molecular formula C8H8F3NO3 and a molecular weight of 223.15 g/mol. Its IUPAC name is 1-methyl-3-(2,2,2-trifluoro-1,1-dihydroxyethyl)pyridin-2-one.
| Compound Name | 1-methyl-3-(2,2,2-trifluoro-1,1-dihydroxyethyl)pyridin-2-one |
|---|---|
| PubChem CID | 10911161 |
| Molecular Formula | C8H8F3NO3 |
| Molecular Weight | 223.15 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | 1-methyl-3-(2,2,2-trifluoro-1,1-dihydroxyethyl)pyridin-2-one |
| SMILES | Cn1cccc(C(O)(O)C(F)(F)F)c1=O |
| InChI | InChI=1S/C8H8F3NO3/c1-12-4-2-3-5(6(12)13)7(14,15)8(9,10)11/h2-4,14-15H,1H3 |
| InChIKey | LNXCUJPQIUWORT-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.15 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|